C29H49N5O6S — CID 130300628
ethyl 2-[(1R,3R)-3-[[(2R,3S)-1-amino-2-[(2R)-1,2-dimethylpyrrolidine-2-carbonyl]-3-methyl-1-oxopentan-2-yl]-methylamino]-1-(ethylcarbamoyloxy)-4-methylpentyl]-1,3-thiazole-4-carboxylate (PubChem CID 130300628) has the molecular formula C29H49N5O6S and a molecular weight of 595.81 g/mol. Its IUPAC name is ethyl 2-[(1R,3R)-3-[[(2R,3S)-1-amino-2-[(2R)-1,2-dimethylpyrrolidine-2-carbonyl]-3-methyl-1-oxopentan-2-yl]-methylamino]-1-(ethylcarbamoyloxy)-4-methylpentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(1R,3R)-3-[[(2R,3S)-1-amino-2-[(2R)-1,2-dimethylpyrrolidine-2-carbonyl]-3-methyl-1-oxopentan-2-yl]-methylamino]-1-(ethylcarbamoyloxy)-4-methylpentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 130300628 |
| Molecular Formula | C29H49N5O6S |
| Molecular Weight | 595.81 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | ethyl 2-[(1R,3R)-3-[[(2R,3S)-1-amino-2-[(2R)-1,2-dimethylpyrrolidine-2-carbonyl]-3-methyl-1-oxopentan-2-yl]-methylamino]-1-(ethylcarbamoyloxy)-4-methylpentyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCNC(=O)O[C@H](C[C@H](C(C)C)N(C)[C@@](C(N)=O)(C(=O)[C@@]1(C)CCCN1C)[C@@H](C)CC)c1nc(C(=O)OCC)cs1 |
| InChI | InChI=1S/C29H49N5O6S/c1-10-19(6)29(26(30)37,25(36)28(7)14-13-15-33(28)8)34(9)21(18(4)5)16-22(40-27(38)31-11-2)23-32-20(17-41-23)24(35)39-12-3/h17-19,21-22H,10-16H2,1-9H3,(H2,30,37)(H,31,38)/t19-,21+,22+,28+,29+/m0/s1 |
| InChIKey | IREQWNUKWKSUFU-BBWALOKWSA-N |
| XLogP | 3.78 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.81 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|