C44H39Cl2N7O6 — CID 130300697
4-(2,4-dichloro-5-methoxyanilino)-7-[3-[4-[2-(1,3-dioxoisoindol-2-yl)-3-(1H-indol-3-yl)propanoyl]piperazin-1-yl]propoxy]-6-methoxyquinoline-3-carbonitrile (PubChem CID 130300697) has the molecular formula C44H39Cl2N7O6 and a molecular weight of 832.75 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-methoxyanilino)-7-[3-[4-[2-(1,3-dioxoisoindol-2-yl)-3-(1H-indol-3-yl)propanoyl]piperazin-1-yl]propoxy]-6-methoxyquinoline-3-carbonitrile.
| Compound Name | 4-(2,4-dichloro-5-methoxyanilino)-7-[3-[4-[2-(1,3-dioxoisoindol-2-yl)-3-(1H-indol-3-yl)propanoyl]piperazin-1-yl]propoxy]-6-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 130300697 |
| Molecular Formula | C44H39Cl2N7O6 |
| Molecular Weight | 832.75 g/mol |
| Exact Mass | 831.23 |
| IUPAC Name | 4-(2,4-dichloro-5-methoxyanilino)-7-[3-[4-[2-(1,3-dioxoisoindol-2-yl)-3-(1H-indol-3-yl)propanoyl]piperazin-1-yl]propoxy]-6-methoxyquinoline-3-carbonitrile |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(OCCCN4CCN(C(=O)C(Cc5c[nH]c6ccccc56)N5C(=O)c6ccccc6C5=O)CC4)c(OC)cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C44H39Cl2N7O6/c1-57-38-22-36(32(45)20-33(38)46)50-41-27(23-47)25-49-35-21-40(39(58-2)19-31(35)41)59-17-7-12-51-13-15-52(16-14-51)44(56)37(18-26-24-48-34-11-6-5-8-28(26)34)53-42(54)29-9-3-4-10-30(29)43(53)55/h3-6,8-11,19-22,24-25,37,48H,7,12-18H2,1-2H3,(H,49,50) |
| InChIKey | IOOLARYXSBCNBW-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.75 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|