C20H21F3N4O5S — CID 130302449
(4aS,7R,8aR)-4a-[5-[(2,5-difluoro-3-pyridinyl)oxy]-2-fluorophenyl]-7-(methoxymethyl)-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-3-amine (PubChem CID 130302449) has the molecular formula C20H21F3N4O5S and a molecular weight of 486.47 g/mol. Its IUPAC name is (4aS,7R,8aR)-4a-[5-[(2,5-difluoro-3-pyridinyl)oxy]-2-fluorophenyl]-7-(methoxymethyl)-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-3-amine.
| Compound Name | (4aS,7R,8aR)-4a-[5-[(2,5-difluoro-3-pyridinyl)oxy]-2-fluorophenyl]-7-(methoxymethyl)-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-3-amine |
|---|---|
| PubChem CID | 130302449 |
| Molecular Formula | C20H21F3N4O5S |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (4aS,7R,8aR)-4a-[5-[(2,5-difluoro-3-pyridinyl)oxy]-2-fluorophenyl]-7-(methoxymethyl)-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-3-amine |
| SMILES | COC[C@H]1C[C@@H]2[C@](c3cc(Oc4cc(F)cnc4F)ccc3F)(CO1)N=C(N)N(C)S2(=O)=O |
| InChI | InChI=1S/C20H21F3N4O5S/c1-27-19(24)26-20(10-31-13(9-30-2)7-17(20)33(27,28)29)14-6-12(3-4-15(14)22)32-16-5-11(21)8-25-18(16)23/h3-6,8,13,17H,7,9-10H2,1-2H3,(H2,24,26)/t13-,17-,20-/m1/s1 |
| InChIKey | OGEVSLFGHQATOX-YXKFXFPPSA-N |
| XLogP | 1.88 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|