C17H14BrF2N3OS — CID 130302975
3-amino-N-[2-(4-bromo-2,5-difluorophenyl)ethyl]-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 130302975) has the molecular formula C17H14BrF2N3OS and a molecular weight of 426.29 g/mol. Its IUPAC name is 3-amino-N-[2-(4-bromo-2,5-difluorophenyl)ethyl]-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[2-(4-bromo-2,5-difluorophenyl)ethyl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130302975 |
| Molecular Formula | C17H14BrF2N3OS |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 3-amino-N-[2-(4-bromo-2,5-difluorophenyl)ethyl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc2c(N)c(C(=O)NCCc3cc(F)c(Br)cc3F)sc2n1 |
| InChI | InChI=1S/C17H14BrF2N3OS/c1-8-2-3-10-14(21)15(25-17(10)23-8)16(24)22-5-4-9-6-13(20)11(18)7-12(9)19/h2-3,6-7H,4-5,21H2,1H3,(H,22,24) |
| InChIKey | HJZYMWNTGZWNQR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|