C26H24F3N3O4S — CID 130303031
(4aS,7R,8aR)-4a-[2-fluoro-5-[(3-fluoro-2-pyridinyl)oxy]phenyl]-7-(4-fluorophenyl)-2,2-dimethyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-3-amine (PubChem CID 130303031) has the molecular formula C26H24F3N3O4S and a molecular weight of 531.56 g/mol. Its IUPAC name is (4aS,7R,8aR)-4a-[2-fluoro-5-[(3-fluoro-2-pyridinyl)oxy]phenyl]-7-(4-fluorophenyl)-2,2-dimethyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-3-amine.
| Compound Name | (4aS,7R,8aR)-4a-[2-fluoro-5-[(3-fluoro-2-pyridinyl)oxy]phenyl]-7-(4-fluorophenyl)-2,2-dimethyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-3-amine |
|---|---|
| PubChem CID | 130303031 |
| Molecular Formula | C26H24F3N3O4S |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | (4aS,7R,8aR)-4a-[2-fluoro-5-[(3-fluoro-2-pyridinyl)oxy]phenyl]-7-(4-fluorophenyl)-2,2-dimethyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-3-amine |
| SMILES | CC1(C)C(N)=N[C@@]2(c3cc(Oc4ncccc4F)ccc3F)CO[C@@H](c3ccc(F)cc3)C[C@H]2S1(=O)=O |
| InChI | InChI=1S/C26H24F3N3O4S/c1-25(2)24(30)32-26(18-12-17(9-10-19(18)28)36-23-20(29)4-3-11-31-23)14-35-21(13-22(26)37(25,33)34)15-5-7-16(27)8-6-15/h3-12,21-22H,13-14H2,1-2H3,(H2,30,32)/t21-,22-,26-/m1/s1 |
| InChIKey | AHJOKRHJPSGPFR-XLGIIRLISA-N |
| XLogP | 4.58 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |