C11H16N4O — CID 130303316
3-hydrazinyl-5-prop-2-enyl-5,6,7,8-tetrahydro-1H-quinoxalin-2-one (PubChem CID 130303316) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 3-hydrazinyl-5-prop-2-enyl-5,6,7,8-tetrahydro-1H-quinoxalin-2-one.
| Compound Name | 3-hydrazinyl-5-prop-2-enyl-5,6,7,8-tetrahydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 130303316 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3-hydrazinyl-5-prop-2-enyl-5,6,7,8-tetrahydro-1H-quinoxalin-2-one |
| SMILES | C=CCC1CCCc2[nH]c(=O)c(NN)nc21 |
| InChI | InChI=1S/C11H16N4O/c1-2-4-7-5-3-6-8-9(7)14-10(15-12)11(16)13-8/h2,7H,1,3-6,12H2,(H,13,16)(H,14,15) |
| InChIKey | PJAULCOLKZLTNU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|