C14H16N4O3S — CID 130303472
(3aS,6S,7aS)-6-amino-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one (PubChem CID 130303472) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is (3aS,6S,7aS)-6-amino-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one.
| Compound Name | (3aS,6S,7aS)-6-amino-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 130303472 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (3aS,6S,7aS)-6-amino-3-(3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
| SMILES | N[C@H]1CC[C@H]2[C@H](C1)OC(=O)N2c1ccc2c(n1)NC(=O)CS2 |
| InChI | InChI=1S/C14H16N4O3S/c15-7-1-2-8-9(5-7)21-14(20)18(8)11-4-3-10-13(16-11)17-12(19)6-22-10/h3-4,7-9H,1-2,5-6,15H2,(H,16,17,19)/t7-,8-,9-/m0/s1 |
| InChIKey | SGEMRIROFKFZNU-CIUDSAMLSA-N |
| XLogP | 1.33 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |