C19H23F17O4S — CID 130303658
1-[2-ethoxy-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)propoxy]-3-methoxypropan-2-ol (PubChem CID 130303658) has the molecular formula C19H23F17O4S and a molecular weight of 670.42 g/mol. Its IUPAC name is 1-[2-ethoxy-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)propoxy]-3-methoxypropan-2-ol.
| Compound Name | 1-[2-ethoxy-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)propoxy]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 130303658 |
| Molecular Formula | C19H23F17O4S |
| Molecular Weight | 670.42 g/mol |
| Exact Mass | 670.10 |
| IUPAC Name | 1-[2-ethoxy-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)propoxy]-3-methoxypropan-2-ol |
| SMILES | CCOC(COCC(O)COC)CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H23F17O4S/c1-3-40-11(8-39-7-10(37)6-38-2)9-41-5-4-12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)36/h10-11,37H,3-9H2,1-2H3 |
| InChIKey | OLBPEYXSMCNXMV-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.42 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|