C11H28N4 — CID 130303694
1-N,1-N,4-N,4-N-tetramethyl-2-N-[2-(methylamino)ethyl]butane-1,2,4-triamine (PubChem CID 130303694) has the molecular formula C11H28N4 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-N,1-N,4-N,4-N-tetramethyl-2-N-[2-(methylamino)ethyl]butane-1,2,4-triamine.
| Compound Name | 1-N,1-N,4-N,4-N-tetramethyl-2-N-[2-(methylamino)ethyl]butane-1,2,4-triamine |
|---|---|
| PubChem CID | 130303694 |
| Molecular Formula | C11H28N4 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.23 |
| IUPAC Name | 1-N,1-N,4-N,4-N-tetramethyl-2-N-[2-(methylamino)ethyl]butane-1,2,4-triamine |
| SMILES | CNCCNC(CCN(C)C)CN(C)C |
| InChI | InChI=1S/C11H28N4/c1-12-7-8-13-11(10-15(4)5)6-9-14(2)3/h11-13H,6-10H2,1-5H3 |
| InChIKey | GICREUXPUBBWOH-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|