C15H33F3N4O2S — CID 130303695
N-[2-[1,4-bis(diethylamino)butan-2-ylamino]ethyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 130303695) has the molecular formula C15H33F3N4O2S and a molecular weight of 390.52 g/mol. Its IUPAC name is N-[2-[1,4-bis(diethylamino)butan-2-ylamino]ethyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[1,4-bis(diethylamino)butan-2-ylamino]ethyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 130303695 |
| Molecular Formula | C15H33F3N4O2S |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-[2-[1,4-bis(diethylamino)butan-2-ylamino]ethyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCN(CC)CCC(CN(CC)CC)NCCNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H33F3N4O2S/c1-5-21(6-2)12-9-14(13-22(7-3)8-4)19-10-11-20-25(23,24)15(16,17)18/h14,19-20H,5-13H2,1-4H3 |
| InChIKey | SVVKEJWCUQMNIX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|