About 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane
1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane (PubChem CID 13030519) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane.
Molecular Properties
| Compound Name | 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane |
| PubChem CID | 13030519 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane |
| SMILES | CC(C)(C)C12C3CC4C(C41)C32 |
| InChI | InChI=1S/C11H16/c1-10(2,3)11-6-4-5-7(8(5)11)9(6)11/h5-9H,4H2,1-3H3 |
| InChIKey | WJWRMFQVOVSWBX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane?
The IUPAC name of 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane (CID 13030519) is 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane.
What is the SMILES notation for 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane?
The canonical SMILES for 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane is CC(C)(C)C12C3CC4C(C41)C32.
What is the InChIKey of 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane?
The InChIKey is WJWRMFQVOVSWBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16/c1-10(2,3)11-6-4-5-7(8(5)11)9(6)11/h5-9H,4H2,1-3H3.
What are the key properties of 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane?
1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane has a molecular weight of 148.25 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyltetracyclo[3.2.0.02,7.04,6]heptane is sourced from PubChem (CID 13030519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).