About CID 13030526
CID 13030526 (PubChem CID 13030526) has the molecular formula C7H7Li
and a molecular weight of 98.07 g/mol.
Molecular Properties
| Compound Name | CID 13030526 |
| PubChem CID | 13030526 |
| Molecular Formula | C7H7Li |
| Molecular Weight | 98.07 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | — |
| SMILES | [C-]1=CC2C=CC1C2.[Li+] |
| InChI | InChI=1S/C7H7.Li/c1-2-7-4-3-6(1)5-7;/h1-3,6-7H,5H2;/q-1;+1 |
| InChIKey | DYJCMNFHDMJHGZ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.07 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 13030526 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13030526?
The IUPAC name of CID 13030526 (CID 13030526) is not available.
What is the SMILES notation for CID 13030526?
The canonical SMILES for CID 13030526 is [C-]1=CC2C=CC1C2.[Li+].
What is the InChIKey of CID 13030526?
The InChIKey is DYJCMNFHDMJHGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.Li/c1-2-7-4-3-6(1)5-7;/h1-3,6-7H,5H2;/q-1;+1.
What are the key properties of CID 13030526?
CID 13030526 has a molecular weight of 98.07 g/mol, XLogP of -1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13030526 is sourced from PubChem (CID 13030526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).