C15H24OS — CID 130305299
2-(1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yloxymethyl)thiolane (PubChem CID 130305299) has the molecular formula C15H24OS and a molecular weight of 252.42 g/mol. Its IUPAC name is 2-(1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yloxymethyl)thiolane.
| Compound Name | 2-(1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yloxymethyl)thiolane |
|---|---|
| PubChem CID | 130305299 |
| Molecular Formula | C15H24OS |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-(1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yloxymethyl)thiolane |
| SMILES | C1=CC(OCC2CCCS2)C2CCCCC2C1 |
| InChI | InChI=1S/C15H24OS/c1-2-8-14-12(5-1)6-3-9-15(14)16-11-13-7-4-10-17-13/h3,9,12-15H,1-2,4-8,10-11H2 |
| InChIKey | MBLIGVJECSHNMK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|