C11H16O3 — CID 130305314
(1Z)-2,4-dimethyl-1-(2-methyl-1,3-dioxolan-2-yl)penta-1,4-dien-3-one (PubChem CID 130305314) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1Z)-2,4-dimethyl-1-(2-methyl-1,3-dioxolan-2-yl)penta-1,4-dien-3-one.
| Compound Name | (1Z)-2,4-dimethyl-1-(2-methyl-1,3-dioxolan-2-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 130305314 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1Z)-2,4-dimethyl-1-(2-methyl-1,3-dioxolan-2-yl)penta-1,4-dien-3-one |
| SMILES | C=C(C)C(=O)/C(C)=C\C1(C)OCCO1 |
| InChI | InChI=1S/C11H16O3/c1-8(2)10(12)9(3)7-11(4)13-5-6-14-11/h7H,1,5-6H2,2-4H3/b9-7- |
| InChIKey | OSXBLIFTXKCOBV-CLFYSBASSA-N |
| XLogP | 1.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|