About 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile
2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile (PubChem CID 130305800) has the molecular formula C15H19ClFN3
and a molecular weight of 295.79 g/mol. Its IUPAC name is 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile |
| PubChem CID | 130305800 |
| Molecular Formula | C15H19ClFN3 |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile |
| SMILES | CC[C@@]1(C)CCCC[C@H]1Nc1nc(Cl)c(C#N)cc1F |
| InChI | InChI=1S/C15H19ClFN3/c1-3-15(2)7-5-4-6-12(15)19-14-11(17)8-10(9-18)13(16)20-14/h8,12H,3-7H2,1-2H3,(H,19,20)/t12-,15+/m1/s1 |
| InChIKey | IEVYLZFFZXMTGL-DOMZBBRYSA-N |
| XLogP | 4.52 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile?
The IUPAC name of 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile (CID 130305800) is 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile.
What is the SMILES notation for 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile?
The canonical SMILES for 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile is CC[C@@]1(C)CCCC[C@H]1Nc1nc(Cl)c(C#N)cc1F.
What is the InChIKey of 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile?
The InChIKey is IEVYLZFFZXMTGL-DOMZBBRYSA-N. The full InChI is InChI=1S/C15H19ClFN3/c1-3-15(2)7-5-4-6-12(15)19-14-11(17)8-10(9-18)13(16)20-14/h8,12H,3-7H2,1-2H3,(H,19,20)/t12-,15+/m1/s1.
What are the key properties of 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile?
2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile has a molecular weight of 295.79 g/mol, XLogP of 4.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-[[(1R,2S)-2-ethyl-2-methylcyclohexyl]amino]-5-fluoropyridine-3-carbonitrile is sourced from PubChem (CID 130305800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).