About (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene
(2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene (PubChem CID 130305823) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene.
Molecular Properties
| Compound Name | (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene |
| PubChem CID | 130305823 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene |
| SMILES | C/C=C\C=C(/C)OC(C)(C)CCOCC |
| InChI | InChI=1S/C13H24O2/c1-6-8-9-12(3)15-13(4,5)10-11-14-7-2/h6,8-9H,7,10-11H2,1-5H3/b8-6-,12-9+ |
| InChIKey | DAMVOPQQKAGMRT-ZHAQITPWSA-N |
| XLogP | 3.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene?
The IUPAC name of (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene (CID 130305823) is (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene.
What is the SMILES notation for (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene?
The canonical SMILES for (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene is C/C=C\C=C(/C)OC(C)(C)CCOCC.
What is the InChIKey of (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene?
The InChIKey is DAMVOPQQKAGMRT-ZHAQITPWSA-N. The full InChI is InChI=1S/C13H24O2/c1-6-8-9-12(3)15-13(4,5)10-11-14-7-2/h6,8-9H,7,10-11H2,1-5H3/b8-6-,12-9+.
What are the key properties of (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene?
(2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene has a molecular weight of 212.33 g/mol, XLogP of 3.69, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-2-(4-ethoxy-2-methylbutan-2-yl)oxyhexa-2,4-diene is sourced from PubChem (CID 130305823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).