C21H32O7S — CID 130305907
tert-butyl 2-[(4R)-2,2-dimethyl-6-[2-(4-methylphenyl)sulfonyloxyethyl]-1,3-dioxan-4-yl]acetate (PubChem CID 130305907) has the molecular formula C21H32O7S and a molecular weight of 428.55 g/mol. Its IUPAC name is tert-butyl 2-[(4R)-2,2-dimethyl-6-[2-(4-methylphenyl)sulfonyloxyethyl]-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R)-2,2-dimethyl-6-[2-(4-methylphenyl)sulfonyloxyethyl]-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 130305907 |
| Molecular Formula | C21H32O7S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | tert-butyl 2-[(4R)-2,2-dimethyl-6-[2-(4-methylphenyl)sulfonyloxyethyl]-1,3-dioxan-4-yl]acetate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC2C[C@H](CC(=O)OC(C)(C)C)OC(C)(C)O2)cc1 |
| InChI | InChI=1S/C21H32O7S/c1-15-7-9-18(10-8-15)29(23,24)25-12-11-16-13-17(27-21(5,6)26-16)14-19(22)28-20(2,3)4/h7-10,16-17H,11-14H2,1-6H3/t16?,17-/m1/s1 |
| InChIKey | RZWLEQOQQWAZHM-ZYMOGRSISA-N |
| XLogP | 3.73 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|