C11H23BrO — CID 130305966
(2S,6R,7R)-2-bromo-7-methoxy-3,6-dimethyloctane (PubChem CID 130305966) has the molecular formula C11H23BrO and a molecular weight of 251.21 g/mol. Its IUPAC name is (2S,6R,7R)-2-bromo-7-methoxy-3,6-dimethyloctane.
| Compound Name | (2S,6R,7R)-2-bromo-7-methoxy-3,6-dimethyloctane |
|---|---|
| PubChem CID | 130305966 |
| Molecular Formula | C11H23BrO |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (2S,6R,7R)-2-bromo-7-methoxy-3,6-dimethyloctane |
| SMILES | CO[C@H](C)[C@H](C)CCC(C)[C@H](C)Br |
| InChI | InChI=1S/C11H23BrO/c1-8(10(3)12)6-7-9(2)11(4)13-5/h8-11H,6-7H2,1-5H3/t8?,9-,10+,11-/m1/s1 |
| InChIKey | OUHZPNAYYIGWLG-HUAZRZQGSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|