About 1-propan-2-ylpyrazine
1-propan-2-ylpyrazine (PubChem CID 130306158) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 1-propan-2-ylpyrazine.
Molecular Properties
| Compound Name | 1-propan-2-ylpyrazine |
| PubChem CID | 130306158 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 1-propan-2-ylpyrazine |
| SMILES | CC(C)N1C=C=NC=C1 |
| InChI | InChI=1S/C7H10N2/c1-7(2)9-5-3-8-4-6-9/h3,5-7H,1-2H3 |
| InChIKey | FKBIMNNOJRVNFM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-propan-2-ylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-ylpyrazine?
The IUPAC name of 1-propan-2-ylpyrazine (CID 130306158) is 1-propan-2-ylpyrazine.
What is the SMILES notation for 1-propan-2-ylpyrazine?
The canonical SMILES for 1-propan-2-ylpyrazine is CC(C)N1C=C=NC=C1.
What is the InChIKey of 1-propan-2-ylpyrazine?
The InChIKey is FKBIMNNOJRVNFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-7(2)9-5-3-8-4-6-9/h3,5-7H,1-2H3.
What are the key properties of 1-propan-2-ylpyrazine?
1-propan-2-ylpyrazine has a molecular weight of 122.17 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-ylpyrazine is sourced from PubChem (CID 130306158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).