C28H32Cl2N6O — CID 130306332
(1S,4R)-4-[[1-[2,6-dichloro-4-[(4-methylpiperazin-1-yl)methyl]benzenecarboximidoyl]-6-imino-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 130306332) has the molecular formula C28H32Cl2N6O and a molecular weight of 539.51 g/mol. Its IUPAC name is (1S,4R)-4-[[1-[2,6-dichloro-4-[(4-methylpiperazin-1-yl)methyl]benzenecarboximidoyl]-6-imino-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S,4R)-4-[[1-[2,6-dichloro-4-[(4-methylpiperazin-1-yl)methyl]benzenecarboximidoyl]-6-imino-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 130306332 |
| Molecular Formula | C28H32Cl2N6O |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | (1S,4R)-4-[[1-[2,6-dichloro-4-[(4-methylpiperazin-1-yl)methyl]benzenecarboximidoyl]-6-imino-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | [H]/N=C(\c1c(Cl)cc(CN2CCN(C)CC2)cc1Cl)n1cc(O[C@@H]2CC[C@H](N)c3ccccc32)cc/c1=N\[H] |
| InChI | InChI=1S/C28H32Cl2N6O/c1-34-10-12-35(13-11-34)16-18-14-22(29)27(23(30)15-18)28(33)36-17-19(6-9-26(36)32)37-25-8-7-24(31)20-4-2-3-5-21(20)25/h2-6,9,14-15,17,24-25,32-33H,7-8,10-13,16,31H2,1H3/b32-26+,33-28+/t24-,25+/m0/s1 |
| InChIKey | PLYALSIFGUYQEC-PJAJKMGSSA-N |
| XLogP | 4.81 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|