About [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine
[2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine (PubChem CID 130306461) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine.
Molecular Properties
| Compound Name | [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine |
| PubChem CID | 130306461 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine |
| SMILES | [H]/N=C/C1=C(/C=C\CC)C(C)CCC1C |
| InChI | InChI=1S/C13H21N/c1-4-5-6-12-10(2)7-8-11(3)13(12)9-14/h5-6,9-11,14H,4,7-8H2,1-3H3/b6-5-,14-9+ |
| InChIKey | HOCNOCTVVWPMED-HMLIUESASA-N |
| XLogP | 3.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine?
The IUPAC name of [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine (CID 130306461) is [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine.
What is the SMILES notation for [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine?
The canonical SMILES for [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine is [H]/N=C/C1=C(/C=C\CC)C(C)CCC1C.
What is the InChIKey of [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine?
The InChIKey is HOCNOCTVVWPMED-HMLIUESASA-N. The full InChI is InChI=1S/C13H21N/c1-4-5-6-12-10(2)7-8-11(3)13(12)9-14/h5-6,9-11,14H,4,7-8H2,1-3H3/b6-5-,14-9+.
What are the key properties of [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine?
[2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine has a molecular weight of 191.32 g/mol, XLogP of 3.96, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(Z)-but-1-enyl]-3,6-dimethylcyclohexen-1-yl]methanimine is sourced from PubChem (CID 130306461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).