C14H21NO2 — CID 130306818
8-butoxy-2,3,4,5-tetrahydro-1H-3-benzazepin-5-ol (PubChem CID 130306818) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 8-butoxy-2,3,4,5-tetrahydro-1H-3-benzazepin-5-ol.
| Compound Name | 8-butoxy-2,3,4,5-tetrahydro-1H-3-benzazepin-5-ol |
|---|---|
| PubChem CID | 130306818 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 8-butoxy-2,3,4,5-tetrahydro-1H-3-benzazepin-5-ol |
| SMILES | CCCCOc1ccc2c(c1)CCNCC2O |
| InChI | InChI=1S/C14H21NO2/c1-2-3-8-17-12-4-5-13-11(9-12)6-7-15-10-14(13)16/h4-5,9,14-16H,2-3,6-8,10H2,1H3 |
| InChIKey | LAXWDBQTYNAQPT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|