C20H30S — CID 130306909
5-methyl-2-propan-2-yl-6-[(2E)-3,6,7-trimethylocta-2,4,5-trien-2-yl]-2H-thiopyran (PubChem CID 130306909) has the molecular formula C20H30S and a molecular weight of 302.53 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yl-6-[(2E)-3,6,7-trimethylocta-2,4,5-trien-2-yl]-2H-thiopyran.
| Compound Name | 5-methyl-2-propan-2-yl-6-[(2E)-3,6,7-trimethylocta-2,4,5-trien-2-yl]-2H-thiopyran |
|---|---|
| PubChem CID | 130306909 |
| Molecular Formula | C20H30S |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 5-methyl-2-propan-2-yl-6-[(2E)-3,6,7-trimethylocta-2,4,5-trien-2-yl]-2H-thiopyran |
| SMILES | CC(=C=C/C(C)=C(\C)C1=C(C)C=CC(C(C)C)S1)C(C)C |
| InChI | InChI=1S/C20H30S/c1-13(2)15(5)9-10-16(6)18(8)20-17(7)11-12-19(21-20)14(3)4/h10-14,19H,1-8H3/b18-16+ |
| InChIKey | HKMRYQNCPPZVNT-FBMGVBCBSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|