C17H16Cl3NO5 — CID 130307102
5-[1-(methoxymethoxymethyl)cyclobutyl]-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 130307102) has the molecular formula C17H16Cl3NO5 and a molecular weight of 420.68 g/mol. Its IUPAC name is 5-[1-(methoxymethoxymethyl)cyclobutyl]-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-[1-(methoxymethoxymethyl)cyclobutyl]-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 130307102 |
| Molecular Formula | C17H16Cl3NO5 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 5-[1-(methoxymethoxymethyl)cyclobutyl]-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carboxylic acid |
| SMILES | COCOCC1(c2onc(-c3c(Cl)cc(Cl)cc3Cl)c2C(=O)O)CCC1 |
| InChI | InChI=1S/C17H16Cl3NO5/c1-24-8-25-7-17(3-2-4-17)15-13(16(22)23)14(21-26-15)12-10(19)5-9(18)6-11(12)20/h5-6H,2-4,7-8H2,1H3,(H,22,23) |
| InChIKey | NDDZQMZCBAKJJE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|