C38H33F — CID 130307286
1-fluoro-4-[4-[[4-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]-(4-phenylphenyl)methyl]phenyl]benzene (PubChem CID 130307286) has the molecular formula C38H33F and a molecular weight of 508.68 g/mol. Its IUPAC name is 1-fluoro-4-[4-[[4-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]-(4-phenylphenyl)methyl]phenyl]benzene.
| Compound Name | 1-fluoro-4-[4-[[4-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]-(4-phenylphenyl)methyl]phenyl]benzene |
|---|---|
| PubChem CID | 130307286 |
| Molecular Formula | C38H33F |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 1-fluoro-4-[4-[[4-[(2Z,4Z)-hepta-2,4-dienyl]phenyl]-(4-phenylphenyl)methyl]phenyl]benzene |
| SMILES | CC/C=C\C=C/Cc1ccc(C(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H33F/c1-2-3-4-5-7-10-29-13-15-34(16-14-29)38(35-21-17-31(18-22-35)30-11-8-6-9-12-30)36-23-19-32(20-24-36)33-25-27-37(39)28-26-33/h3-9,11-28,38H,2,10H2,1H3/b4-3-,7-5- |
| InChIKey | ULRKJUSNQWOROM-MRWCJKGFSA-N |
| XLogP | 10.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|