C19H20F3N5O3 — CID 130307302
methyl 2-[6-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (PubChem CID 130307302) has the molecular formula C19H20F3N5O3 and a molecular weight of 423.40 g/mol. Its IUPAC name is methyl 2-[6-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate.
| Compound Name | methyl 2-[6-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
|---|---|
| PubChem CID | 130307302 |
| Molecular Formula | C19H20F3N5O3 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | methyl 2-[6-(2,2-dimethylpropanoylamino)-4-(trifluoromethyl)-3-pyridinyl]-1,4-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
| SMILES | COC(=O)c1cc2n(c1)NC(c1cnc(NC(=O)C(C)(C)C)cc1C(F)(F)F)=NC2 |
| InChI | InChI=1S/C19H20F3N5O3/c1-18(2,3)17(29)25-14-6-13(19(20,21)22)12(8-23-14)15-24-7-11-5-10(16(28)30-4)9-27(11)26-15/h5-6,8-9H,7H2,1-4H3,(H,24,26)(H,23,25,29) |
| InChIKey | CTBDZQOAVADBEW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |