C25H17Cl3N2O5 — CID 130307331
(E)-3-[1-[5-(1-methoxycyclopropyl)-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid (PubChem CID 130307331) has the molecular formula C25H17Cl3N2O5 and a molecular weight of 531.78 g/mol. Its IUPAC name is (E)-3-[1-[5-(1-methoxycyclopropyl)-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[5-(1-methoxycyclopropyl)-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 130307331 |
| Molecular Formula | C25H17Cl3N2O5 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | (E)-3-[1-[5-(1-methoxycyclopropyl)-3-(2,4,6-trichlorophenyl)-1,2-oxazole-4-carbonyl]indol-4-yl]prop-2-enoic acid |
| SMILES | COC1(c2onc(-c3c(Cl)cc(Cl)cc3Cl)c2C(=O)n2ccc3c(/C=C/C(=O)O)cccc32)CC1 |
| InChI | InChI=1S/C25H17Cl3N2O5/c1-34-25(8-9-25)23-21(22(29-35-23)20-16(27)11-14(26)12-17(20)28)24(33)30-10-7-15-13(5-6-19(31)32)3-2-4-18(15)30/h2-7,10-12H,8-9H2,1H3,(H,31,32)/b6-5+ |
| InChIKey | PXBRVLPBVPDPSB-AATRIKPKSA-N |
| XLogP | 6.68 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|