C16H19ClN4O — CID 130307404
7-chloro-5-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1H-1,6-naphthyridin-2-one (PubChem CID 130307404) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is 7-chloro-5-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1H-1,6-naphthyridin-2-one.
| Compound Name | 7-chloro-5-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 130307404 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 7-chloro-5-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]amino]-1H-1,6-naphthyridin-2-one |
| SMILES | CN1[C@@H]2CC[C@H]1CC(Nc1nc(Cl)cc3[nH]c(=O)ccc13)C2 |
| InChI | InChI=1S/C16H19ClN4O/c1-21-10-2-3-11(21)7-9(6-10)18-16-12-4-5-15(22)19-13(12)8-14(17)20-16/h4-5,8-11H,2-3,6-7H2,1H3,(H,18,20)(H,19,22)/t9?,10-,11+ |
| InChIKey | JBXQHDHODZIMOI-FGWVZKOKSA-N |
| XLogP | 2.61 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|