C27H36N2O5S — CID 130307685
(1R,10S,11R,12R,15S,21R)-4-(azepan-1-yl)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one (PubChem CID 130307685) has the molecular formula C27H36N2O5S and a molecular weight of 500.66 g/mol. Its IUPAC name is (1R,10S,11R,12R,15S,21R)-4-(azepan-1-yl)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one.
| Compound Name | (1R,10S,11R,12R,15S,21R)-4-(azepan-1-yl)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one |
|---|---|
| PubChem CID | 130307685 |
| Molecular Formula | C27H36N2O5S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (1R,10S,11R,12R,15S,21R)-4-(azepan-1-yl)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one |
| SMILES | C=C1C(=O)[C@@]23C(CC[C@@H]1[C@H]2O)[C@@]12CO[C@@]3(O)[C@@H](O)C1C(C)(C)Cc1sc(N3CCCCCC3)nc12 |
| InChI | InChI=1S/C27H36N2O5S/c1-14-15-8-9-17-25-13-34-27(33,26(17,20(14)30)21(15)31)22(32)18(25)24(2,3)12-16-19(25)28-23(35-16)29-10-6-4-5-7-11-29/h15,17-18,21-22,31-33H,1,4-13H2,2-3H3/t15-,17?,18?,21+,22-,25-,26-,27-/m0/s1 |
| InChIKey | JLNGWRXXLKJCMI-JDUWEFLGSA-N |
| XLogP | 2.57 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|