About [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine
[(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine (PubChem CID 130307871) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine.
Molecular Properties
| Compound Name | [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine |
| PubChem CID | 130307871 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine |
| SMILES | CC1(C)CC(N=C=O)C[C@@](C)(CN)C1 |
| InChI | InChI=1S/C11H20N2O/c1-10(2)4-9(13-8-14)5-11(3,6-10)7-12/h9H,4-7,12H2,1-3H3/t9?,11-/m1/s1 |
| InChIKey | PALQTQJKAPQMCL-HCCKASOXSA-N |
| XLogP | 1.87 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine?
The IUPAC name of [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine (CID 130307871) is [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine.
What is the SMILES notation for [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine?
The canonical SMILES for [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine is CC1(C)CC(N=C=O)C[C@@](C)(CN)C1.
What is the InChIKey of [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine?
The InChIKey is PALQTQJKAPQMCL-HCCKASOXSA-N. The full InChI is InChI=1S/C11H20N2O/c1-10(2)4-9(13-8-14)5-11(3,6-10)7-12/h9H,4-7,12H2,1-3H3/t9?,11-/m1/s1.
What are the key properties of [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine?
[(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine has a molecular weight of 196.29 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-5-isocyanato-1,3,3-trimethylcyclohexyl]methanamine is sourced from PubChem (CID 130307871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).