C12H14N2 — CID 130307956
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridin-2-imine (PubChem CID 130307956) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridin-2-imine.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridin-2-imine |
|---|---|
| PubChem CID | 130307956 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyridin-2-imine |
| SMILES | [H]/N=c1\ccccn1C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C12H14N2/c1-3-7-11(8-4-2)14-10-6-5-9-12(14)13/h3-10,13H,1H2,2H3/b8-4-,11-7+,13-12+ |
| InChIKey | VSCLEOYOMLKBMQ-SUDAHGPTSA-N |
| XLogP | 2.57 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|