C26H23NO7S — CID 130308005
[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(3-hydroxyphenyl)ethoxy]methyl benzoate (PubChem CID 130308005) has the molecular formula C26H23NO7S and a molecular weight of 493.54 g/mol. Its IUPAC name is [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(3-hydroxyphenyl)ethoxy]methyl benzoate.
| Compound Name | [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(3-hydroxyphenyl)ethoxy]methyl benzoate |
|---|---|
| PubChem CID | 130308005 |
| Molecular Formula | C26H23NO7S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | [2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(3-hydroxyphenyl)ethoxy]methyl benzoate |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCC(OCOC(=O)c3ccccc3)c3cccc(O)c3)cc2)S1 |
| InChI | InChI=1S/C26H23NO7S/c28-20-8-4-7-19(14-20)22(33-16-34-25(30)18-5-2-1-3-6-18)15-32-21-11-9-17(10-12-21)13-23-24(29)27-26(31)35-23/h1-12,14,22-23,28H,13,15-16H2,(H,27,29,31) |
| InChIKey | VQUOUNGSWLATTA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|