C10H15FO — CID 130308041
(2Z,4Z,6E)-6-(fluoromethylidene)-8-methoxyocta-2,4-diene (PubChem CID 130308041) has the molecular formula C10H15FO and a molecular weight of 170.23 g/mol. Its IUPAC name is (2Z,4Z,6E)-6-(fluoromethylidene)-8-methoxyocta-2,4-diene.
| Compound Name | (2Z,4Z,6E)-6-(fluoromethylidene)-8-methoxyocta-2,4-diene |
|---|---|
| PubChem CID | 130308041 |
| Molecular Formula | C10H15FO |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (2Z,4Z,6E)-6-(fluoromethylidene)-8-methoxyocta-2,4-diene |
| SMILES | C/C=C\C=C/C(=C/F)CCOC |
| InChI | InChI=1S/C10H15FO/c1-3-4-5-6-10(9-11)7-8-12-2/h3-6,9H,7-8H2,1-2H3/b4-3-,6-5-,10-9- |
| InChIKey | QJYCFIQUXIFYIV-BNGSOVGLSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|