C21H26F3N3O3S — CID 130308297
[2-methylsulfonyl-4-[3-propan-2-yl-4-[6-(trifluoromethyl)-3-pyridinyl]piperazin-1-yl]phenyl]methanol (PubChem CID 130308297) has the molecular formula C21H26F3N3O3S and a molecular weight of 457.52 g/mol. Its IUPAC name is [2-methylsulfonyl-4-[3-propan-2-yl-4-[6-(trifluoromethyl)-3-pyridinyl]piperazin-1-yl]phenyl]methanol.
| Compound Name | [2-methylsulfonyl-4-[3-propan-2-yl-4-[6-(trifluoromethyl)-3-pyridinyl]piperazin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 130308297 |
| Molecular Formula | C21H26F3N3O3S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | [2-methylsulfonyl-4-[3-propan-2-yl-4-[6-(trifluoromethyl)-3-pyridinyl]piperazin-1-yl]phenyl]methanol |
| SMILES | CC(C)C1CN(c2ccc(CO)c(S(C)(=O)=O)c2)CCN1c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C21H26F3N3O3S/c1-14(2)18-12-26(16-5-4-15(13-28)19(10-16)31(3,29)30)8-9-27(18)17-6-7-20(25-11-17)21(22,23)24/h4-7,10-11,14,18,28H,8-9,12-13H2,1-3H3 |
| InChIKey | UTDAXXUUCUHZOH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|