C16H25FN2O2 — CID 130308313
tert-butyl (3R)-3-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]piperazine-1-carboxylate (PubChem CID 130308313) has the molecular formula C16H25FN2O2 and a molecular weight of 296.39 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 130308313 |
| Molecular Formula | C16H25FN2O2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | tert-butyl (3R)-3-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]piperazine-1-carboxylate |
| SMILES | C=C(/C=C\C(F)=C/C)[C@@H]1CN(C(=O)OC(C)(C)C)CCN1 |
| InChI | InChI=1S/C16H25FN2O2/c1-6-13(17)8-7-12(2)14-11-19(10-9-18-14)15(20)21-16(3,4)5/h6-8,14,18H,2,9-11H2,1,3-5H3/b8-7-,13-6+/t14-/m0/s1 |
| InChIKey | MZXOVSPGZJCXBU-SINWKOSNSA-N |
| XLogP | 3.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|