C6H15N3O — CID 13030915
1-(2-aminoethyl)-3-propan-2-ylurea (PubChem CID 13030915) has the molecular formula C6H15N3O and a molecular weight of 145.21 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-propan-2-ylurea.
| Compound Name | 1-(2-aminoethyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 13030915 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 1-(2-aminoethyl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCCN |
| InChI | InChI=1S/C6H15N3O/c1-5(2)9-6(10)8-4-3-7/h5H,3-4,7H2,1-2H3,(H2,8,9,10) |
| InChIKey | AKJJTXGNHCANIF-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |