About 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid
8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid (PubChem CID 130309301) has the molecular formula C22H28N2O3PS+
and a molecular weight of 431.52 g/mol. Its IUPAC name is 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid.
Molecular Properties
| Compound Name | 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid |
| PubChem CID | 130309301 |
| Molecular Formula | C22H28N2O3PS+ |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid |
| SMILES | O=P(O)(O)CCCCCCCC[n+]1ccc(-c2ccc(-c3cncs3)cc2)cc1 |
| InChI | InChI=1S/C22H27N2O3PS/c25-28(26,27)16-6-4-2-1-3-5-13-24-14-11-20(12-15-24)19-7-9-21(10-8-19)22-17-23-18-29-22/h7-12,14-15,17-18H,1-6,13,16H2,(H-,25,26,27)/p+1 |
| InChIKey | QOJKPBMPBPGCLX-UHFFFAOYSA-O |
| XLogP | 5.28 |
| TPSA | 74.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid?
The IUPAC name of 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid (CID 130309301) is 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid.
What is the SMILES notation for 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid?
The canonical SMILES for 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid is O=P(O)(O)CCCCCCCC[n+]1ccc(-c2ccc(-c3cncs3)cc2)cc1.
What is the InChIKey of 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid?
The InChIKey is QOJKPBMPBPGCLX-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H27N2O3PS/c25-28(26,27)16-6-4-2-1-3-5-13-24-14-11-20(12-15-24)19-7-9-21(10-8-19)22-17-23-18-29-22/h7-12,14-15,17-18H,1-6,13,16H2,(H-,25,26,27)/p+1.
What are the key properties of 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid?
8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid has a molecular weight of 431.52 g/mol, XLogP of 5.28, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-[4-(1,3-thiazol-5-yl)phenyl]pyridin-1-ium-1-yl]octylphosphonic acid is sourced from PubChem (CID 130309301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).