About 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine
6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine (PubChem CID 130309830) has the molecular formula C18H17F3N4O
and a molecular weight of 362.36 g/mol. Its IUPAC name is 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine.
Molecular Properties
| Compound Name | 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine |
| PubChem CID | 130309830 |
| Molecular Formula | C18H17F3N4O |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine |
| SMILES | Cc1ccc(OCc2cn(-c3ccc(F)c(C(C)(F)F)c3)nn2)nc1C |
| InChI | InChI=1S/C18H17F3N4O/c1-11-4-7-17(22-12(11)2)26-10-13-9-25(24-23-13)14-5-6-16(19)15(8-14)18(3,20)21/h4-9H,10H2,1-3H3 |
| InChIKey | PKXTZVWHAUOXPT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine?
The IUPAC name of 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine (CID 130309830) is 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine.
What is the SMILES notation for 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine?
The canonical SMILES for 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine is Cc1ccc(OCc2cn(-c3ccc(F)c(C(C)(F)F)c3)nn2)nc1C.
What is the InChIKey of 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine?
The InChIKey is PKXTZVWHAUOXPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F3N4O/c1-11-4-7-17(22-12(11)2)26-10-13-9-25(24-23-13)14-5-6-16(19)15(8-14)18(3,20)21/h4-9H,10H2,1-3H3.
What are the key properties of 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine?
6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine has a molecular weight of 362.36 g/mol, XLogP of 4.11, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[1-[3-(1,1-difluoroethyl)-4-fluorophenyl]triazol-4-yl]methoxy]-2,3-dimethylpyridine is sourced from PubChem (CID 130309830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).