About 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine
2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine (PubChem CID 130309873) has the molecular formula C13H9F2N5O
and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine.
Molecular Properties
| Compound Name | 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine |
| PubChem CID | 130309873 |
| Molecular Formula | C13H9F2N5O |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine |
| SMILES | Fc1cccc(-n2cc(COc3ncccn3)nn2)c1F |
| InChI | InChI=1S/C13H9F2N5O/c14-10-3-1-4-11(12(10)15)20-7-9(18-19-20)8-21-13-16-5-2-6-17-13/h1-7H,8H2 |
| InChIKey | MWMFDQPXYFRZFX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine?
The IUPAC name of 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine (CID 130309873) is 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine.
What is the SMILES notation for 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine?
The canonical SMILES for 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine is Fc1cccc(-n2cc(COc3ncccn3)nn2)c1F.
What is the InChIKey of 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine?
The InChIKey is MWMFDQPXYFRZFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F2N5O/c14-10-3-1-4-11(12(10)15)20-7-9(18-19-20)8-21-13-16-5-2-6-17-13/h1-7H,8H2.
What are the key properties of 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine?
2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine has a molecular weight of 289.25 g/mol, XLogP of 1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,3-difluorophenyl)triazol-4-yl]methoxy]pyrimidine is sourced from PubChem (CID 130309873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).