C15H17F7N3OPS — CID 130310029
(2,3,3,3-tetrafluoro-2-phosphanylpropyl) (NE,1E)-N-[1-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]ethylidene]ethanehydrazonate (PubChem CID 130310029) has the molecular formula C15H17F7N3OPS and a molecular weight of 451.35 g/mol. Its IUPAC name is (2,3,3,3-tetrafluoro-2-phosphanylpropyl) (NE,1E)-N-[1-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]ethylidene]ethanehydrazonate.
| Compound Name | (2,3,3,3-tetrafluoro-2-phosphanylpropyl) (NE,1E)-N-[1-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]ethylidene]ethanehydrazonate |
|---|---|
| PubChem CID | 130310029 |
| Molecular Formula | C15H17F7N3OPS |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | (2,3,3,3-tetrafluoro-2-phosphanylpropyl) (NE,1E)-N-[1-[3-ethylsulfanyl-5-(trifluoromethyl)-2-pyridinyl]ethylidene]ethanehydrazonate |
| SMILES | CCSc1cc(C(F)(F)F)cnc1/C(C)=N/N=C(\C)OCC(F)(P)C(F)(F)F |
| InChI | InChI=1S/C15H17F7N3OPS/c1-4-28-11-5-10(14(17,18)19)6-23-12(11)8(2)24-25-9(3)26-7-13(16,27)15(20,21)22/h5-6H,4,7,27H2,1-3H3/b24-8+,25-9+ |
| InChIKey | GYNKHCODTHPHRL-IQEGOQEASA-N |
| XLogP | 5.47 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|