C19H27F3N2O3S — CID 130310090
N-[(2R,3S)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide (PubChem CID 130310090) has the molecular formula C19H27F3N2O3S and a molecular weight of 420.50 g/mol. Its IUPAC name is N-[(2R,3S)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide.
| Compound Name | N-[(2R,3S)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 130310090 |
| Molecular Formula | C19H27F3N2O3S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[(2R,3S)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCN[C@H]1COC1CCC(c2c(F)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C19H27F3N2O3S/c1-28(25,26)24-16-3-2-10-23-17(16)11-27-13-6-4-12(5-7-13)18-14(20)8-9-15(21)19(18)22/h8-9,12-13,16-17,23-24H,2-7,10-11H2,1H3/t12?,13?,16-,17-/m0/s1 |
| InChIKey | REOONBLHEVHLQF-SMELUJQZSA-N |
| XLogP | 2.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|