About N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide
N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide (PubChem CID 130310356) has the molecular formula C21H34N2O3S
and a molecular weight of 394.58 g/mol. Its IUPAC name is N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide |
| PubChem CID | 130310356 |
| Molecular Formula | C21H34N2O3S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide |
| SMILES | CCc1ccccc1C1CCC(OC[C@@H]2NCCC[C@@H]2NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C21H34N2O3S/c1-3-16-7-4-5-8-19(16)17-10-12-18(13-11-17)26-15-21-20(9-6-14-22-21)23-27(2,24)25/h4-5,7-8,17-18,20-23H,3,6,9-15H2,1-2H3/t17?,18?,20-,21-/m0/s1 |
| InChIKey | JVHFPOYMKAKDAT-RQWVFBBXSA-N |
| XLogP | 2.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide?
The IUPAC name of N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide (CID 130310356) is N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide.
What is the SMILES notation for N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide?
The canonical SMILES for N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide is CCc1ccccc1C1CCC(OC[C@@H]2NCCC[C@@H]2NS(C)(=O)=O)CC1.
What is the InChIKey of N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide?
The InChIKey is JVHFPOYMKAKDAT-RQWVFBBXSA-N. The full InChI is InChI=1S/C21H34N2O3S/c1-3-16-7-4-5-8-19(16)17-10-12-18(13-11-17)26-15-21-20(9-6-14-22-21)23-27(2,24)25/h4-5,7-8,17-18,20-23H,3,6,9-15H2,1-2H3/t17?,18?,20-,21-/m0/s1.
What are the key properties of N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide?
N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide has a molecular weight of 394.58 g/mol, XLogP of 2.96, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3S)-2-[[4-(2-ethylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide is sourced from PubChem (CID 130310356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).