About N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide
N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide (PubChem CID 130310365) has the molecular formula C20H32N2O3S
and a molecular weight of 380.55 g/mol. Its IUPAC name is N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide |
| PubChem CID | 130310365 |
| Molecular Formula | C20H32N2O3S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide |
| SMILES | Cc1ccccc1C1CCC(OC[C@@H]2NCCC[C@@H]2NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C20H32N2O3S/c1-15-6-3-4-7-18(15)16-9-11-17(12-10-16)25-14-20-19(8-5-13-21-20)22-26(2,23)24/h3-4,6-7,16-17,19-22H,5,8-14H2,1-2H3/t16?,17?,19-,20-/m0/s1 |
| InChIKey | FAZZKRDKUCQYGV-WXDAQCLHSA-N |
| XLogP | 2.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide?
The IUPAC name of N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide (CID 130310365) is N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide.
What is the SMILES notation for N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide?
The canonical SMILES for N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide is Cc1ccccc1C1CCC(OC[C@@H]2NCCC[C@@H]2NS(C)(=O)=O)CC1.
What is the InChIKey of N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide?
The InChIKey is FAZZKRDKUCQYGV-WXDAQCLHSA-N. The full InChI is InChI=1S/C20H32N2O3S/c1-15-6-3-4-7-18(15)16-9-11-17(12-10-16)25-14-20-19(8-5-13-21-20)22-26(2,23)24/h3-4,6-7,16-17,19-22H,5,8-14H2,1-2H3/t16?,17?,19-,20-/m0/s1.
What are the key properties of N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide?
N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide has a molecular weight of 380.55 g/mol, XLogP of 2.71, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3S)-2-[[4-(2-methylphenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide is sourced from PubChem (CID 130310365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).