C48H55NO2 — CID 130310532
2-[4-(2,4-dihexoxyphenyl)phenyl]-7-(2,4-dimethylphenyl)-1-hepta-4,6-diyn-3-yl-3-methylindolizine (PubChem CID 130310532) has the molecular formula C48H55NO2 and a molecular weight of 677.97 g/mol. Its IUPAC name is 2-[4-(2,4-dihexoxyphenyl)phenyl]-7-(2,4-dimethylphenyl)-1-hepta-4,6-diyn-3-yl-3-methylindolizine.
| Compound Name | 2-[4-(2,4-dihexoxyphenyl)phenyl]-7-(2,4-dimethylphenyl)-1-hepta-4,6-diyn-3-yl-3-methylindolizine |
|---|---|
| PubChem CID | 130310532 |
| Molecular Formula | C48H55NO2 |
| Molecular Weight | 677.97 g/mol |
| Exact Mass | 677.42 |
| IUPAC Name | 2-[4-(2,4-dihexoxyphenyl)phenyl]-7-(2,4-dimethylphenyl)-1-hepta-4,6-diyn-3-yl-3-methylindolizine |
| SMILES | C#CC#CC(CC)c1c(-c2ccc(-c3ccc(OCCCCCC)cc3OCCCCCC)cc2)c(C)n2ccc(-c3ccc(C)cc3C)cc12 |
| InChI | InChI=1S/C48H55NO2/c1-8-12-15-17-30-50-42-25-27-44(46(34-42)51-31-18-16-13-9-2)39-21-23-40(24-22-39)47-37(7)49-29-28-41(43-26-20-35(5)32-36(43)6)33-45(49)48(47)38(11-4)19-14-10-3/h3,20-29,32-34,38H,8-9,11-13,15-18,30-31H2,1-2,4-7H3 |
| InChIKey | XWXNRZZCKAOWJR-UHFFFAOYSA-N |
| XLogP | 12.91 |
| TPSA | 22.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.97 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|