C57H61NO4S — CID 130310538
5-[2-[4-(2,4-dihexoxyphenyl)phenyl]-1-heptan-3-yl-7-(2-hexa-1,3,5-triynoxy-4-methylphenyl)indolizin-3-yl]thiophene-2-carbaldehyde (PubChem CID 130310538) has the molecular formula C57H61NO4S and a molecular weight of 856.18 g/mol. Its IUPAC name is 5-[2-[4-(2,4-dihexoxyphenyl)phenyl]-1-heptan-3-yl-7-(2-hexa-1,3,5-triynoxy-4-methylphenyl)indolizin-3-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[2-[4-(2,4-dihexoxyphenyl)phenyl]-1-heptan-3-yl-7-(2-hexa-1,3,5-triynoxy-4-methylphenyl)indolizin-3-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 130310538 |
| Molecular Formula | C57H61NO4S |
| Molecular Weight | 856.18 g/mol |
| Exact Mass | 855.43 |
| IUPAC Name | 5-[2-[4-(2,4-dihexoxyphenyl)phenyl]-1-heptan-3-yl-7-(2-hexa-1,3,5-triynoxy-4-methylphenyl)indolizin-3-yl]thiophene-2-carbaldehyde |
| SMILES | C#CC#CC#COc1cc(C)ccc1-c1ccn2c(-c3ccc(C=O)s3)c(-c3ccc(-c4ccc(OCCCCCC)cc4OCCCCCC)cc3)c(C(CC)CCCC)c2c1 |
| InChI | InChI=1S/C57H61NO4S/c1-7-12-16-19-35-60-47-28-31-49(53(40-47)62-37-21-18-14-9-3)44-24-26-45(27-25-44)56-55(43(11-5)22-15-10-4)51-39-46(33-34-58(51)57(56)54-32-29-48(41-59)63-54)50-30-23-42(6)38-52(50)61-36-20-17-13-8-2/h2,23-34,38-41,43H,7,9-12,14-16,18-19,21-22,35,37H2,1,3-6H3 |
| InChIKey | DAHZGUAGOGNQBV-UHFFFAOYSA-N |
| XLogP | 15.37 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.18 |
| LogP ≤ 5 | 15.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|