About 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine]
1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine] (PubChem CID 130310608) has the molecular formula C15H23NO
and a molecular weight of 233.36 g/mol. Its IUPAC name is 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine].
Molecular Properties
| Compound Name | 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine] |
| PubChem CID | 130310608 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine] |
| SMILES | CC(C)N1CCC2(CC1)OCC1C=CC=CC12 |
| InChI | InChI=1S/C15H23NO/c1-12(2)16-9-7-15(8-10-16)14-6-4-3-5-13(14)11-17-15/h3-6,12-14H,7-11H2,1-2H3 |
| InChIKey | VOVHTUNMWUGFNO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine]?
The IUPAC name of 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine] (CID 130310608) is 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine].
What is the SMILES notation for 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine]?
The canonical SMILES for 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine] is CC(C)N1CCC2(CC1)OCC1C=CC=CC12.
What is the InChIKey of 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine]?
The InChIKey is VOVHTUNMWUGFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-12(2)16-9-7-15(8-10-16)14-6-4-3-5-13(14)11-17-15/h3-6,12-14H,7-11H2,1-2H3.
What are the key properties of 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine]?
1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine] has a molecular weight of 233.36 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-propan-2-ylspiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine] is sourced from PubChem (CID 130310608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).