C12H15N3O3 — CID 130310666
10-hydroxy-6,12-dimethyl-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione (PubChem CID 130310666) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 10-hydroxy-6,12-dimethyl-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione.
| Compound Name | 10-hydroxy-6,12-dimethyl-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
|---|---|
| PubChem CID | 130310666 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 10-hydroxy-6,12-dimethyl-1,3,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-8,11-dione |
| SMILES | Cc1cn2c(c(O)c1=O)C(=O)N1C(C)CCN1C2 |
| InChI | InChI=1S/C12H15N3O3/c1-7-5-13-6-14-4-3-8(2)15(14)12(18)9(13)11(17)10(7)16/h5,8,17H,3-4,6H2,1-2H3 |
| InChIKey | JLTGNUQQTKAJGP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |