C18H18N2O — CID 130311150
(2E)-2-ethenyl-1-[2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1H-imidazol-5-yl]penta-2,4-dien-1-one (PubChem CID 130311150) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is (2E)-2-ethenyl-1-[2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1H-imidazol-5-yl]penta-2,4-dien-1-one.
| Compound Name | (2E)-2-ethenyl-1-[2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1H-imidazol-5-yl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 130311150 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (2E)-2-ethenyl-1-[2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1H-imidazol-5-yl]penta-2,4-dien-1-one |
| SMILES | C=C/C=C\C(=C/C=C)c1ncc(C(=O)/C(C=C)=C/C=C)[nH]1 |
| InChI | InChI=1S/C18H18N2O/c1-5-9-12-15(11-7-3)18-19-13-16(20-18)17(21)14(8-4)10-6-2/h5-13H,1-4H2,(H,19,20)/b12-9-,14-10+,15-11+ |
| InChIKey | SVDNZZGONPWALO-SLCDUTSESA-N |
| XLogP | 4.20 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|