About 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol
2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol (PubChem CID 130311440) has the molecular formula C5H9N7O
and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol |
| PubChem CID | 130311440 |
| Molecular Formula | C5H9N7O |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol |
| SMILES | Cn1nc(N=[N+]=[N-])nc1NCCO |
| InChI | InChI=1S/C5H9N7O/c1-12-5(7-2-3-13)8-4(10-12)9-11-6/h13H,2-3H2,1H3,(H,7,8,10) |
| InChIKey | JXZUIOXQCPKZHY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol?
The IUPAC name of 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol (CID 130311440) is 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol.
What is the SMILES notation for 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol?
The canonical SMILES for 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol is Cn1nc(N=[N+]=[N-])nc1NCCO.
What is the InChIKey of 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol?
The InChIKey is JXZUIOXQCPKZHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N7O/c1-12-5(7-2-3-13)8-4(10-12)9-11-6/h13H,2-3H2,1H3,(H,7,8,10).
What are the key properties of 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol?
2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol has a molecular weight of 183.17 g/mol, XLogP of 0.16, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-azido-2-methyl-1,2,4-triazol-3-yl)amino]ethanol is sourced from PubChem (CID 130311440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).