About (3R)-N,N,3-trimethyloct-1-en-4-amine
(3R)-N,N,3-trimethyloct-1-en-4-amine (PubChem CID 130311586) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is (3R)-N,N,3-trimethyloct-1-en-4-amine.
Molecular Properties
| Compound Name | (3R)-N,N,3-trimethyloct-1-en-4-amine |
| PubChem CID | 130311586 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (3R)-N,N,3-trimethyloct-1-en-4-amine |
| SMILES | C=C[C@@H](C)C(CCCC)N(C)C |
| InChI | InChI=1S/C11H23N/c1-6-8-9-11(12(4)5)10(3)7-2/h7,10-11H,2,6,8-9H2,1,3-5H3/t10-,11?/m1/s1 |
| InChIKey | XEDVSBBVZMVDBN-NFJWQWPMSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-N,N,3-trimethyloct-1-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N,N,3-trimethyloct-1-en-4-amine?
The IUPAC name of (3R)-N,N,3-trimethyloct-1-en-4-amine (CID 130311586) is (3R)-N,N,3-trimethyloct-1-en-4-amine.
What is the SMILES notation for (3R)-N,N,3-trimethyloct-1-en-4-amine?
The canonical SMILES for (3R)-N,N,3-trimethyloct-1-en-4-amine is C=C[C@@H](C)C(CCCC)N(C)C.
What is the InChIKey of (3R)-N,N,3-trimethyloct-1-en-4-amine?
The InChIKey is XEDVSBBVZMVDBN-NFJWQWPMSA-N. The full InChI is InChI=1S/C11H23N/c1-6-8-9-11(12(4)5)10(3)7-2/h7,10-11H,2,6,8-9H2,1,3-5H3/t10-,11?/m1/s1.
What are the key properties of (3R)-N,N,3-trimethyloct-1-en-4-amine?
(3R)-N,N,3-trimethyloct-1-en-4-amine has a molecular weight of 169.31 g/mol, XLogP of 2.93, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N,N,3-trimethyloct-1-en-4-amine is sourced from PubChem (CID 130311586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).